Unprecedented zirconium(II) complexes bearing tethered olefin−phosphine ligands were
synthesized and characterized. The molecular structures of the newly synthesized complexes
(η5-1,2-Me2C5H3)2Zr(CH2CHCH2CH2PPh2) (1c) and Cp2Zr(CH2CHCH2CH2CH2PPh2) (2a)
were determined by single-crystal X-ray diffraction methods. The stability and reactivity of
the series of complexes Cp2Zr{CH2CH(CH2)nPR2} (n = 2, 3; R = Et, Ph) were examined.
The complex 2a showed simultaneously both sufficient stability and high reactivity.